C23H24N2O4 — CID 120691741
1-[3-(cyclohexanecarbonylamino)benzoyl]-2,3-dihydroindole-3-carboxylic acid (PubChem CID 120691741) has the molecular formula C23H24N2O4 and a molecular weight of 392.46 g/mol. Its IUPAC name is 1-[3-(cyclohexanecarbonylamino)benzoyl]-2,3-dihydroindole-3-carboxylic acid.
| Compound Name | 1-[3-(cyclohexanecarbonylamino)benzoyl]-2,3-dihydroindole-3-carboxylic acid |
|---|---|
| PubChem CID | 120691741 |
| Molecular Formula | C23H24N2O4 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 1-[3-(cyclohexanecarbonylamino)benzoyl]-2,3-dihydroindole-3-carboxylic acid |
| SMILES | O=C(Nc1cccc(C(=O)N2CC(C(=O)O)c3ccccc32)c1)C1CCCCC1 |
| InChI | InChI=1S/C23H24N2O4/c26-21(15-7-2-1-3-8-15)24-17-10-6-9-16(13-17)22(27)25-14-19(23(28)29)18-11-4-5-12-20(18)25/h4-6,9-13,15,19H,1-3,7-8,14H2,(H,24,26)(H,28,29) |
| InChIKey | ONFXSFIQXMPHTN-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |