C13H24N2O6S — CID 120692493
(E)-2-[[2-(2-propan-2-yloxyethylsulfonylamino)acetyl]amino]hex-4-enoic acid (PubChem CID 120692493) has the molecular formula C13H24N2O6S and a molecular weight of 336.41 g/mol. Its IUPAC name is (E)-2-[[2-(2-propan-2-yloxyethylsulfonylamino)acetyl]amino]hex-4-enoic acid.
| Compound Name | (E)-2-[[2-(2-propan-2-yloxyethylsulfonylamino)acetyl]amino]hex-4-enoic acid |
|---|---|
| PubChem CID | 120692493 |
| Molecular Formula | C13H24N2O6S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | (E)-2-[[2-(2-propan-2-yloxyethylsulfonylamino)acetyl]amino]hex-4-enoic acid |
| SMILES | C/C=C/CC(NC(=O)CNS(=O)(=O)CCOC(C)C)C(=O)O |
| InChI | InChI=1S/C13H24N2O6S/c1-4-5-6-11(13(17)18)15-12(16)9-14-22(19,20)8-7-21-10(2)3/h4-5,10-11,14H,6-9H2,1-3H3,(H,15,16)(H,17,18)/b5-4+ |
| InChIKey | FIRAVVZKHMOWNF-SNAWJCMRSA-N |
| XLogP | -0.13 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|