About 2-[4-(3,4-dihydro-1H-isothiochromene-1-carbonylamino)pyrazol-1-yl]-2-methylpropanoic acid
2-[4-(3,4-dihydro-1H-isothiochromene-1-carbonylamino)pyrazol-1-yl]-2-methylpropanoic acid (PubChem CID 120696310) has the molecular formula C17H19N3O3S
and a molecular weight of 345.42 g/mol. Its IUPAC name is 2-[4-(3,4-dihydro-1H-isothiochromene-1-carbonylamino)pyrazol-1-yl]-2-methylpropanoic acid.
Molecular Properties
| Compound Name | 2-[4-(3,4-dihydro-1H-isothiochromene-1-carbonylamino)pyrazol-1-yl]-2-methylpropanoic acid |
| PubChem CID | 120696310 |
| Molecular Formula | C17H19N3O3S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 2-[4-(3,4-dihydro-1H-isothiochromene-1-carbonylamino)pyrazol-1-yl]-2-methylpropanoic acid |
| SMILES | CC(C)(C(=O)O)n1cc(NC(=O)C2SCCc3ccccc32)cn1 |
| InChI | InChI=1S/C17H19N3O3S/c1-17(2,16(22)23)20-10-12(9-18-20)19-15(21)14-13-6-4-3-5-11(13)7-8-24-14/h3-6,9-10,14H,7-8H2,1-2H3,(H,19,21)(H,22,23) |
| InChIKey | LENIYRXQLXPBDM-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[4-(3,4-dihydro-1H-isothiochromene-1-carbonylamino)pyrazol-1-yl]-2-methylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(3,4-dihydro-1H-isothiochromene-1-carbonylamino)pyrazol-1-yl]-2-methylpropanoic acid?
The IUPAC name of 2-[4-(3,4-dihydro-1H-isothiochromene-1-carbonylamino)pyrazol-1-yl]-2-methylpropanoic acid (CID 120696310) is 2-[4-(3,4-dihydro-1H-isothiochromene-1-carbonylamino)pyrazol-1-yl]-2-methylpropanoic acid.
What is the SMILES notation for 2-[4-(3,4-dihydro-1H-isothiochromene-1-carbonylamino)pyrazol-1-yl]-2-methylpropanoic acid?
The canonical SMILES for 2-[4-(3,4-dihydro-1H-isothiochromene-1-carbonylamino)pyrazol-1-yl]-2-methylpropanoic acid is CC(C)(C(=O)O)n1cc(NC(=O)C2SCCc3ccccc32)cn1.
What is the InChIKey of 2-[4-(3,4-dihydro-1H-isothiochromene-1-carbonylamino)pyrazol-1-yl]-2-methylpropanoic acid?
The InChIKey is LENIYRXQLXPBDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N3O3S/c1-17(2,16(22)23)20-10-12(9-18-20)19-15(21)14-13-6-4-3-5-11(13)7-8-24-14/h3-6,9-10,14H,7-8H2,1-2H3,(H,19,21)(H,22,23).
What are the key properties of 2-[4-(3,4-dihydro-1H-isothiochromene-1-carbonylamino)pyrazol-1-yl]-2-methylpropanoic acid?
2-[4-(3,4-dihydro-1H-isothiochromene-1-carbonylamino)pyrazol-1-yl]-2-methylpropanoic acid has a molecular weight of 345.42 g/mol, XLogP of 2.67, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(3,4-dihydro-1H-isothiochromene-1-carbonylamino)pyrazol-1-yl]-2-methylpropanoic acid is sourced from PubChem (CID 120696310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).