C23H22OS — CID 12072397
(4S)-2,2-dibenzyl-4-phenyl-1,3-oxathiolane (PubChem CID 12072397) has the molecular formula C23H22OS and a molecular weight of 346.50 g/mol. Its IUPAC name is (4S)-2,2-dibenzyl-4-phenyl-1,3-oxathiolane.
| Compound Name | (4S)-2,2-dibenzyl-4-phenyl-1,3-oxathiolane |
|---|---|
| PubChem CID | 12072397 |
| Molecular Formula | C23H22OS |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | (4S)-2,2-dibenzyl-4-phenyl-1,3-oxathiolane |
| SMILES | c1ccc(CC2(Cc3ccccc3)OC[C@H](c3ccccc3)S2)cc1 |
| InChI | InChI=1S/C23H22OS/c1-4-10-19(11-5-1)16-23(17-20-12-6-2-7-13-20)24-18-22(25-23)21-14-8-3-9-15-21/h1-15,22H,16-18H2/t22-/m1/s1 |
| InChIKey | KBZAABTUEPLRKD-JOCHJYFZSA-N |
| XLogP | 5.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |