C10H12OS — CID 15248367
3-phenyl-1,4-oxathiane (PubChem CID 15248367) has the molecular formula C10H12OS and a molecular weight of 180.27 g/mol. Its IUPAC name is 3-phenyl-1,4-oxathiane.
| Compound Name | 3-phenyl-1,4-oxathiane |
|---|---|
| PubChem CID | 15248367 |
| Molecular Formula | C10H12OS |
| Molecular Weight | 180.27 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | 3-phenyl-1,4-oxathiane |
| SMILES | c1ccc(C2COCCS2)cc1 |
| InChI | InChI=1S/C10H12OS/c1-2-4-9(5-3-1)10-8-11-6-7-12-10/h1-5,10H,6-8H2 |
| InChIKey | LLUSWIDFZPBRIU-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.27 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |