About 3-phenyl-1,4-oxathiane
3-phenyl-1,4-oxathiane (PubChem CID 15248367) has the molecular formula C10H12OS
and a molecular weight of 180.27 g/mol. Its IUPAC name is 3-phenyl-1,4-oxathiane.
Molecular Properties
| Compound Name | 3-phenyl-1,4-oxathiane |
| PubChem CID | 15248367 |
| Molecular Formula | C10H12OS |
| Molecular Weight | 180.27 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | 3-phenyl-1,4-oxathiane |
| SMILES | c1ccc(C2COCCS2)cc1 |
| InChI | InChI=1S/C10H12OS/c1-2-4-9(5-3-1)10-8-11-6-7-12-10/h1-5,10H,6-8H2 |
| InChIKey | LLUSWIDFZPBRIU-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.27 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-phenyl-1,4-oxathiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyl-1,4-oxathiane?
The IUPAC name of 3-phenyl-1,4-oxathiane (CID 15248367) is 3-phenyl-1,4-oxathiane.
What is the SMILES notation for 3-phenyl-1,4-oxathiane?
The canonical SMILES for 3-phenyl-1,4-oxathiane is c1ccc(C2COCCS2)cc1.
What is the InChIKey of 3-phenyl-1,4-oxathiane?
The InChIKey is LLUSWIDFZPBRIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12OS/c1-2-4-9(5-3-1)10-8-11-6-7-12-10/h1-5,10H,6-8H2.
What are the key properties of 3-phenyl-1,4-oxathiane?
3-phenyl-1,4-oxathiane has a molecular weight of 180.27 g/mol, XLogP of 2.49, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyl-1,4-oxathiane is sourced from PubChem (CID 15248367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).