C11H11F3OS — CID 10562499
3-[4-(trifluoromethyl)phenyl]-1,4-oxathiane (PubChem CID 10562499) has the molecular formula C11H11F3OS and a molecular weight of 248.27 g/mol. Its IUPAC name is 3-[4-(trifluoromethyl)phenyl]-1,4-oxathiane.
| Compound Name | 3-[4-(trifluoromethyl)phenyl]-1,4-oxathiane |
|---|---|
| PubChem CID | 10562499 |
| Molecular Formula | C11H11F3OS |
| Molecular Weight | 248.27 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | 3-[4-(trifluoromethyl)phenyl]-1,4-oxathiane |
| SMILES | FC(F)(F)c1ccc(C2COCCS2)cc1 |
| InChI | InChI=1S/C11H11F3OS/c12-11(13,14)9-3-1-8(2-4-9)10-7-15-5-6-16-10/h1-4,10H,5-7H2 |
| InChIKey | LAGGNCBBZWEEQA-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.27 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |