C14H16F2OS — CID 71283137
(4aR,8aS)-8a-(2,4-difluorophenyl)-3,4,4a,5,6,8-hexahydro-1H-thiopyrano[3,4-c]pyran (PubChem CID 71283137) has the molecular formula C14H16F2OS and a molecular weight of 270.34 g/mol. Its IUPAC name is (4aR,8aS)-8a-(2,4-difluorophenyl)-3,4,4a,5,6,8-hexahydro-1H-thiopyrano[3,4-c]pyran.
| Compound Name | (4aR,8aS)-8a-(2,4-difluorophenyl)-3,4,4a,5,6,8-hexahydro-1H-thiopyrano[3,4-c]pyran |
|---|---|
| PubChem CID | 71283137 |
| Molecular Formula | C14H16F2OS |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | (4aR,8aS)-8a-(2,4-difluorophenyl)-3,4,4a,5,6,8-hexahydro-1H-thiopyrano[3,4-c]pyran |
| SMILES | Fc1ccc([C@]23COCC[C@@H]2CCSC3)c(F)c1 |
| InChI | InChI=1S/C14H16F2OS/c15-11-1-2-12(13(16)7-11)14-8-17-5-3-10(14)4-6-18-9-14/h1-2,7,10H,3-6,8-9H2/t10-,14+/m1/s1 |
| InChIKey | PKLKLHSFCGFXMH-YGRLFVJLSA-N |
| XLogP | 3.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |