C18H23F3O2S — CID 122500534
5-(methoxymethyl)-2-[4-(3,4,5-trifluorophenyl)cyclohexyl]-1,3-oxathiane (PubChem CID 122500534) has the molecular formula C18H23F3O2S and a molecular weight of 360.44 g/mol. Its IUPAC name is 5-(methoxymethyl)-2-[4-(3,4,5-trifluorophenyl)cyclohexyl]-1,3-oxathiane.
| Compound Name | 5-(methoxymethyl)-2-[4-(3,4,5-trifluorophenyl)cyclohexyl]-1,3-oxathiane |
|---|---|
| PubChem CID | 122500534 |
| Molecular Formula | C18H23F3O2S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 5-(methoxymethyl)-2-[4-(3,4,5-trifluorophenyl)cyclohexyl]-1,3-oxathiane |
| SMILES | COCC1COC(C2CCC(c3cc(F)c(F)c(F)c3)CC2)SC1 |
| InChI | InChI=1S/C18H23F3O2S/c1-22-8-11-9-23-18(24-10-11)13-4-2-12(3-5-13)14-6-15(19)17(21)16(20)7-14/h6-7,11-13,18H,2-5,8-10H2,1H3 |
| InChIKey | HLNNRBWWOMOOJV-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|