C14H18OS — CID 129157599
3-(3,4-dihydro-2H-thiochromen-3-yl)oxane (PubChem CID 129157599) has the molecular formula C14H18OS and a molecular weight of 234.36 g/mol. Its IUPAC name is 3-(3,4-dihydro-2H-thiochromen-3-yl)oxane.
| Compound Name | 3-(3,4-dihydro-2H-thiochromen-3-yl)oxane |
|---|---|
| PubChem CID | 129157599 |
| Molecular Formula | C14H18OS |
| Molecular Weight | 234.36 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | 3-(3,4-dihydro-2H-thiochromen-3-yl)oxane |
| SMILES | c1ccc2c(c1)CC(C1CCCOC1)CS2 |
| InChI | InChI=1S/C14H18OS/c1-2-6-14-11(4-1)8-13(10-16-14)12-5-3-7-15-9-12/h1-2,4,6,12-13H,3,5,7-10H2 |
| InChIKey | GLWYPALUOVRLCI-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.36 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |