C18H20OS — CID 12072425
(5S)-2,2-dibenzyl-5-methyl-1,3-oxathiolane (PubChem CID 12072425) has the molecular formula C18H20OS and a molecular weight of 284.42 g/mol. Its IUPAC name is (5S)-2,2-dibenzyl-5-methyl-1,3-oxathiolane.
| Compound Name | (5S)-2,2-dibenzyl-5-methyl-1,3-oxathiolane |
|---|---|
| PubChem CID | 12072425 |
| Molecular Formula | C18H20OS |
| Molecular Weight | 284.42 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | (5S)-2,2-dibenzyl-5-methyl-1,3-oxathiolane |
| SMILES | C[C@H]1CSC(Cc2ccccc2)(Cc2ccccc2)O1 |
| InChI | InChI=1S/C18H20OS/c1-15-14-20-18(19-15,12-16-8-4-2-5-9-16)13-17-10-6-3-7-11-17/h2-11,15H,12-14H2,1H3/t15-/m0/s1 |
| InChIKey | DFWLDGAIKAHUOZ-HNNXBMFYSA-N |
| XLogP | 4.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.42 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |