C20H23N3OS2 — CID 120729661
[4-(1,3-dithian-2-yl)phenyl]-(2-pyridin-3-ylpiperazin-1-yl)methanone (PubChem CID 120729661) has the molecular formula C20H23N3OS2 and a molecular weight of 385.56 g/mol. Its IUPAC name is [4-(1,3-dithian-2-yl)phenyl]-(2-pyridin-3-ylpiperazin-1-yl)methanone.
| Compound Name | [4-(1,3-dithian-2-yl)phenyl]-(2-pyridin-3-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 120729661 |
| Molecular Formula | C20H23N3OS2 |
| Molecular Weight | 385.56 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | [4-(1,3-dithian-2-yl)phenyl]-(2-pyridin-3-ylpiperazin-1-yl)methanone |
| SMILES | O=C(c1ccc(C2SCCCS2)cc1)N1CCNCC1c1cccnc1 |
| InChI | InChI=1S/C20H23N3OS2/c24-19(15-4-6-16(7-5-15)20-25-11-2-12-26-20)23-10-9-22-14-18(23)17-3-1-8-21-13-17/h1,3-8,13,18,20,22H,2,9-12,14H2 |
| InChIKey | QSTRTOFNRMWSEH-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.56 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |