C18H21Cl2N3OS — CID 120730039
2-(2-chlorophenyl)sulfanyl-1-(2-pyridin-3-ylpiperazin-1-yl)propan-1-one;hydrochloride (PubChem CID 120730039) has the molecular formula C18H21Cl2N3OS and a molecular weight of 398.36 g/mol. Its IUPAC name is 2-(2-chlorophenyl)sulfanyl-1-(2-pyridin-3-ylpiperazin-1-yl)propan-1-one;hydrochloride.
| Compound Name | 2-(2-chlorophenyl)sulfanyl-1-(2-pyridin-3-ylpiperazin-1-yl)propan-1-one;hydrochloride |
|---|---|
| PubChem CID | 120730039 |
| Molecular Formula | C18H21Cl2N3OS |
| Molecular Weight | 398.36 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | 2-(2-chlorophenyl)sulfanyl-1-(2-pyridin-3-ylpiperazin-1-yl)propan-1-one;hydrochloride |
| SMILES | CC(Sc1ccccc1Cl)C(=O)N1CCNCC1c1cccnc1.Cl |
| InChI | InChI=1S/C18H20ClN3OS.ClH/c1-13(24-17-7-3-2-6-15(17)19)18(23)22-10-9-21-12-16(22)14-5-4-8-20-11-14;/h2-8,11,13,16,21H,9-10,12H2,1H3;1H |
| InChIKey | ZUBQPCZYQFWPDS-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.36 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |