C19H23Cl2N3O2 — CID 120732044
2-(2-chloro-5-methylphenoxy)-1-(2-pyridin-3-ylpiperazin-1-yl)propan-1-one;hydrochloride (PubChem CID 120732044) has the molecular formula C19H23Cl2N3O2 and a molecular weight of 396.32 g/mol. Its IUPAC name is 2-(2-chloro-5-methylphenoxy)-1-(2-pyridin-3-ylpiperazin-1-yl)propan-1-one;hydrochloride.
| Compound Name | 2-(2-chloro-5-methylphenoxy)-1-(2-pyridin-3-ylpiperazin-1-yl)propan-1-one;hydrochloride |
|---|---|
| PubChem CID | 120732044 |
| Molecular Formula | C19H23Cl2N3O2 |
| Molecular Weight | 396.32 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | 2-(2-chloro-5-methylphenoxy)-1-(2-pyridin-3-ylpiperazin-1-yl)propan-1-one;hydrochloride |
| SMILES | Cc1ccc(Cl)c(OC(C)C(=O)N2CCNCC2c2cccnc2)c1.Cl |
| InChI | InChI=1S/C19H22ClN3O2.ClH/c1-13-5-6-16(20)18(10-13)25-14(2)19(24)23-9-8-22-12-17(23)15-4-3-7-21-11-15;/h3-7,10-11,14,17,22H,8-9,12H2,1-2H3;1H |
| InChIKey | ZRMDIEHTVQAJIX-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.32 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |