C21H23FN4OS — CID 120737054
2-[1-(1H-benzimidazol-2-yl)ethylsulfanyl]-1-[2-(3-fluorophenyl)piperazin-1-yl]ethanone (PubChem CID 120737054) has the molecular formula C21H23FN4OS and a molecular weight of 398.51 g/mol. Its IUPAC name is 2-[1-(1H-benzimidazol-2-yl)ethylsulfanyl]-1-[2-(3-fluorophenyl)piperazin-1-yl]ethanone.
| Compound Name | 2-[1-(1H-benzimidazol-2-yl)ethylsulfanyl]-1-[2-(3-fluorophenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 120737054 |
| Molecular Formula | C21H23FN4OS |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 2-[1-(1H-benzimidazol-2-yl)ethylsulfanyl]-1-[2-(3-fluorophenyl)piperazin-1-yl]ethanone |
| SMILES | CC(SCC(=O)N1CCNCC1c1cccc(F)c1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C21H23FN4OS/c1-14(21-24-17-7-2-3-8-18(17)25-21)28-13-20(27)26-10-9-23-12-19(26)15-5-4-6-16(22)11-15/h2-8,11,14,19,23H,9-10,12-13H2,1H3,(H,24,25) |
| InChIKey | VXFJKOIQZGRLLD-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |