C28H40N4O8 — CID 12074256
N-(3-butoxypropyl)-2-(3-carbamimidoylanilino)-2-[2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]acetamide (PubChem CID 12074256) has the molecular formula C28H40N4O8 and a molecular weight of 560.65 g/mol. Its IUPAC name is N-(3-butoxypropyl)-2-(3-carbamimidoylanilino)-2-[2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]acetamide.
| Compound Name | N-(3-butoxypropyl)-2-(3-carbamimidoylanilino)-2-[2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]acetamide |
|---|---|
| PubChem CID | 12074256 |
| Molecular Formula | C28H40N4O8 |
| Molecular Weight | 560.65 g/mol |
| Exact Mass | 560.28 |
| IUPAC Name | N-(3-butoxypropyl)-2-(3-carbamimidoylanilino)-2-[2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]acetamide |
| SMILES | [H]/N=C(\N)c1cccc(NC(C(=O)NCCCOCCCC)c2ccccc2OC2OC(CO)C(O)C(O)C2O)c1 |
| InChI | InChI=1S/C28H40N4O8/c1-2-3-13-38-14-7-12-31-27(37)22(32-18-9-6-8-17(15-18)26(29)30)19-10-4-5-11-20(19)39-28-25(36)24(35)23(34)21(16-33)40-28/h4-6,8-11,15,21-25,28,32-36H,2-3,7,12-14,16H2,1H3,(H3,29,30)(H,31,37) |
| InChIKey | OHVQJSTYFGWZDN-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 199.61 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.65 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|