C28H38N6O8 — CID 70328384
(2R)-2-(3-carbamimidoylanilino)-N-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]-2-[2-[(2S,4S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]acetamide (PubChem CID 70328384) has the molecular formula C28H38N6O8 and a molecular weight of 586.65 g/mol. Its IUPAC name is (2R)-2-(3-carbamimidoylanilino)-N-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]-2-[2-[(2S,4S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]acetamide.
| Compound Name | (2R)-2-(3-carbamimidoylanilino)-N-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]-2-[2-[(2S,4S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]acetamide |
|---|---|
| PubChem CID | 70328384 |
| Molecular Formula | C28H38N6O8 |
| Molecular Weight | 586.65 g/mol |
| Exact Mass | 586.28 |
| IUPAC Name | (2R)-2-(3-carbamimidoylanilino)-N-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]-2-[2-[(2S,4S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]acetamide |
| SMILES | [H]/N=C(\N)c1cccc(N[C@@H](C(=O)NCC(=O)N2CCN(C)CC2)c2ccccc2O[C@@H]2O[C@H](CO)C(O)[C@H](O)C2O)c1 |
| InChI | InChI=1S/C28H38N6O8/c1-33-9-11-34(12-10-33)21(36)14-31-27(40)22(32-17-6-4-5-16(13-17)26(29)30)18-7-2-3-8-19(18)41-28-25(39)24(38)23(37)20(15-35)42-28/h2-8,13,20,22-25,28,32,35,37-39H,9-12,14-15H2,1H3,(H3,29,30)(H,31,40)/t20-,22-,23?,24+,25?,28-/m1/s1 |
| InChIKey | INQRIAKSJRBAIY-HAUZDRAYSA-N |
| XLogP | -1.81 |
| TPSA | 213.93 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.65 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|