C34H42N6O10 — CID 90990558
2-[3-(N'-hydroxycarbamimidoyl)anilino]-N-[2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-2-[2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]acetamide (PubChem CID 90990558) has the molecular formula C34H42N6O10 and a molecular weight of 694.74 g/mol. Its IUPAC name is 2-[3-(N'-hydroxycarbamimidoyl)anilino]-N-[2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-2-[2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]acetamide.
| Compound Name | 2-[3-(N'-hydroxycarbamimidoyl)anilino]-N-[2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-2-[2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]acetamide |
|---|---|
| PubChem CID | 90990558 |
| Molecular Formula | C34H42N6O10 |
| Molecular Weight | 694.74 g/mol |
| Exact Mass | 694.30 |
| IUPAC Name | 2-[3-(N'-hydroxycarbamimidoyl)anilino]-N-[2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-2-[2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]acetamide |
| SMILES | COc1ccccc1N1CCN(C(=O)CNC(=O)C(Nc2cccc(C(N)=NO)c2)c2ccccc2OC2OC(CO)C(O)C(O)C2O)CC1 |
| InChI | InChI=1S/C34H42N6O10/c1-48-25-12-5-3-10-23(25)39-13-15-40(16-14-39)27(42)18-36-33(46)28(37-21-8-6-7-20(17-21)32(35)38-47)22-9-2-4-11-24(22)49-34-31(45)30(44)29(43)26(19-41)50-34/h2-12,17,26,28-31,34,37,41,43-45,47H,13-16,18-19H2,1H3,(H2,35,38)(H,36,46) |
| InChIKey | SXBLHLXOIBPNPQ-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 231.90 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.74 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|