C17H18BrF2N3O — CID 120755297
1-[[5-bromo-2-(difluoromethoxy)phenyl]methyl]-2-pyridin-3-ylpiperazine (PubChem CID 120755297) has the molecular formula C17H18BrF2N3O and a molecular weight of 398.25 g/mol. Its IUPAC name is 1-[[5-bromo-2-(difluoromethoxy)phenyl]methyl]-2-pyridin-3-ylpiperazine.
| Compound Name | 1-[[5-bromo-2-(difluoromethoxy)phenyl]methyl]-2-pyridin-3-ylpiperazine |
|---|---|
| PubChem CID | 120755297 |
| Molecular Formula | C17H18BrF2N3O |
| Molecular Weight | 398.25 g/mol |
| Exact Mass | 397.06 |
| IUPAC Name | 1-[[5-bromo-2-(difluoromethoxy)phenyl]methyl]-2-pyridin-3-ylpiperazine |
| SMILES | FC(F)Oc1ccc(Br)cc1CN1CCNCC1c1cccnc1 |
| InChI | InChI=1S/C17H18BrF2N3O/c18-14-3-4-16(24-17(19)20)13(8-14)11-23-7-6-22-10-15(23)12-2-1-5-21-9-12/h1-5,8-9,15,17,22H,6-7,10-11H2 |
| InChIKey | AKMPRZDDXLJWRR-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.25 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |