C17H20N2O6S — CID 120763083
methyl 5-[2-(2-methoxyphenyl)piperazin-1-yl]sulfonylfuran-3-carboxylate (PubChem CID 120763083) has the molecular formula C17H20N2O6S and a molecular weight of 380.42 g/mol. Its IUPAC name is methyl 5-[2-(2-methoxyphenyl)piperazin-1-yl]sulfonylfuran-3-carboxylate.
| Compound Name | methyl 5-[2-(2-methoxyphenyl)piperazin-1-yl]sulfonylfuran-3-carboxylate |
|---|---|
| PubChem CID | 120763083 |
| Molecular Formula | C17H20N2O6S |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | methyl 5-[2-(2-methoxyphenyl)piperazin-1-yl]sulfonylfuran-3-carboxylate |
| SMILES | COC(=O)c1coc(S(=O)(=O)N2CCNCC2c2ccccc2OC)c1 |
| InChI | InChI=1S/C17H20N2O6S/c1-23-15-6-4-3-5-13(15)14-10-18-7-8-19(14)26(21,22)16-9-12(11-25-16)17(20)24-2/h3-6,9,11,14,18H,7-8,10H2,1-2H3 |
| InChIKey | WEWKXWUODBTRQN-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 98.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |