C24H26N2O2 — CID 1207854
ethyl (5S)-4-benzyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraene-12-carboxylate (PubChem CID 1207854) has the molecular formula C24H26N2O2 and a molecular weight of 374.48 g/mol. Its IUPAC name is ethyl (5S)-4-benzyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraene-12-carboxylate.
| Compound Name | ethyl (5S)-4-benzyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraene-12-carboxylate |
|---|---|
| PubChem CID | 1207854 |
| Molecular Formula | C24H26N2O2 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | ethyl (5S)-4-benzyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraene-12-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)c1c3n2CCN(Cc2ccccc2)[C@H]3CCC1 |
| InChI | InChI=1S/C24H26N2O2/c1-2-28-24(27)18-11-12-21-20(15-18)19-9-6-10-22-23(19)26(21)14-13-25(22)16-17-7-4-3-5-8-17/h3-5,7-8,11-12,15,22H,2,6,9-10,13-14,16H2,1H3/t22-/m0/s1 |
| InChIKey | UMHOVIQNVMSRPM-QFIPXVFZSA-N |
| XLogP | 4.71 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|