C18H22N2O2 — CID 4213779
ethyl 1,4-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-10(17),11(16),12,14-tetraene-13-carboxylate (PubChem CID 4213779) has the molecular formula C18H22N2O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is ethyl 1,4-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-10(17),11(16),12,14-tetraene-13-carboxylate.
| Compound Name | ethyl 1,4-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-10(17),11(16),12,14-tetraene-13-carboxylate |
|---|---|
| PubChem CID | 4213779 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | ethyl 1,4-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-10(17),11(16),12,14-tetraene-13-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)c1c3n2CCNC3CCCC1 |
| InChI | InChI=1S/C18H22N2O2/c1-2-22-18(21)12-7-8-16-14(11-12)13-5-3-4-6-15-17(13)20(16)10-9-19-15/h7-8,11,15,19H,2-6,9-10H2,1H3 |
| InChIKey | QTODFCWJUUXBKI-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|