C26H28N2 — CID 1208271
(5S)-4-benzyl-12-(cyclopenten-1-yl)-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraene (PubChem CID 1208271) has the molecular formula C26H28N2 and a molecular weight of 368.52 g/mol. Its IUPAC name is (5S)-4-benzyl-12-(cyclopenten-1-yl)-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraene.
| Compound Name | (5S)-4-benzyl-12-(cyclopenten-1-yl)-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraene |
|---|---|
| PubChem CID | 1208271 |
| Molecular Formula | C26H28N2 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | (5S)-4-benzyl-12-(cyclopenten-1-yl)-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraene |
| SMILES | C1=C(c2ccc3c(c2)c2c4n3CCN(Cc3ccccc3)[C@H]4CCC2)CCC1 |
| InChI | InChI=1S/C26H28N2/c1-2-7-19(8-3-1)18-27-15-16-28-24-14-13-21(20-9-4-5-10-20)17-23(24)22-11-6-12-25(27)26(22)28/h1-3,7-9,13-14,17,25H,4-6,10-12,15-16,18H2/t25-/m0/s1 |
| InChIKey | VWWJKZASFNVJTI-VWLOTQADSA-N |
| XLogP | 6.10 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|