C15H20ClN3O4S — CID 120825306
methyl 5-[2-(methylamino)propylsulfamoyl]isoquinoline-1-carboxylate;hydrochloride (PubChem CID 120825306) has the molecular formula C15H20ClN3O4S and a molecular weight of 373.86 g/mol. Its IUPAC name is methyl 5-[2-(methylamino)propylsulfamoyl]isoquinoline-1-carboxylate;hydrochloride.
| Compound Name | methyl 5-[2-(methylamino)propylsulfamoyl]isoquinoline-1-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 120825306 |
| Molecular Formula | C15H20ClN3O4S |
| Molecular Weight | 373.86 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | methyl 5-[2-(methylamino)propylsulfamoyl]isoquinoline-1-carboxylate;hydrochloride |
| SMILES | CNC(C)CNS(=O)(=O)c1cccc2c(C(=O)OC)nccc12.Cl |
| InChI | InChI=1S/C15H19N3O4S.ClH/c1-10(16-2)9-18-23(20,21)13-6-4-5-12-11(13)7-8-17-14(12)15(19)22-3;/h4-8,10,16,18H,9H2,1-3H3;1H |
| InChIKey | PAGIRUHJQZJICX-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.86 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |