C15H19N3O4S — CID 120583450
methyl 5-(4-aminobutylsulfamoyl)isoquinoline-1-carboxylate (PubChem CID 120583450) has the molecular formula C15H19N3O4S and a molecular weight of 337.40 g/mol. Its IUPAC name is methyl 5-(4-aminobutylsulfamoyl)isoquinoline-1-carboxylate.
| Compound Name | methyl 5-(4-aminobutylsulfamoyl)isoquinoline-1-carboxylate |
|---|---|
| PubChem CID | 120583450 |
| Molecular Formula | C15H19N3O4S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | methyl 5-(4-aminobutylsulfamoyl)isoquinoline-1-carboxylate |
| SMILES | COC(=O)c1nccc2c(S(=O)(=O)NCCCCN)cccc12 |
| InChI | InChI=1S/C15H19N3O4S/c1-22-15(19)14-12-5-4-6-13(11(12)7-10-17-14)23(20,21)18-9-3-2-8-16/h4-7,10,18H,2-3,8-9,16H2,1H3 |
| InChIKey | MALQPGXJYJWTOR-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|