C20H22FN7O — CID 120833458
[3-(4-fluorophenyl)imidazol-4-yl]-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methanone (PubChem CID 120833458) has the molecular formula C20H22FN7O and a molecular weight of 395.44 g/mol. Its IUPAC name is [3-(4-fluorophenyl)imidazol-4-yl]-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methanone.
| Compound Name | [3-(4-fluorophenyl)imidazol-4-yl]-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 120833458 |
| Molecular Formula | C20H22FN7O |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | [3-(4-fluorophenyl)imidazol-4-yl]-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methanone |
| SMILES | O=C(c1cncn1-c1ccc(F)cc1)N1CCC(c2nnc3n2CCNC3)CC1 |
| InChI | InChI=1S/C20H22FN7O/c21-15-1-3-16(4-2-15)28-13-23-11-17(28)20(29)26-8-5-14(6-9-26)19-25-24-18-12-22-7-10-27(18)19/h1-4,11,13-14,22H,5-10,12H2 |
| InChIKey | UUOYNQSHBCDPHO-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 80.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |