C12H17ClN4S — CID 120837427
1-[(5-thiophen-3-yl-1H-pyrazol-4-yl)methyl]pyrrolidin-3-amine;hydrochloride (PubChem CID 120837427) has the molecular formula C12H17ClN4S and a molecular weight of 284.82 g/mol. Its IUPAC name is 1-[(5-thiophen-3-yl-1H-pyrazol-4-yl)methyl]pyrrolidin-3-amine;hydrochloride.
| Compound Name | 1-[(5-thiophen-3-yl-1H-pyrazol-4-yl)methyl]pyrrolidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 120837427 |
| Molecular Formula | C12H17ClN4S |
| Molecular Weight | 284.82 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 1-[(5-thiophen-3-yl-1H-pyrazol-4-yl)methyl]pyrrolidin-3-amine;hydrochloride |
| SMILES | Cl.NC1CCN(Cc2cn[nH]c2-c2ccsc2)C1 |
| InChI | InChI=1S/C12H16N4S.ClH/c13-11-1-3-16(7-11)6-10-5-14-15-12(10)9-2-4-17-8-9;/h2,4-5,8,11H,1,3,6-7,13H2,(H,14,15);1H |
| InChIKey | FUVWEUVQNOAXIS-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.82 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |