C20H22N4O2S — CID 167932124
N-(4-hydroxyphenyl)-1-[(5-thiophen-3-yl-1H-pyrazol-4-yl)methyl]piperidine-4-carboxamide (PubChem CID 167932124) has the molecular formula C20H22N4O2S and a molecular weight of 382.49 g/mol. Its IUPAC name is N-(4-hydroxyphenyl)-1-[(5-thiophen-3-yl-1H-pyrazol-4-yl)methyl]piperidine-4-carboxamide.
| Compound Name | N-(4-hydroxyphenyl)-1-[(5-thiophen-3-yl-1H-pyrazol-4-yl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 167932124 |
| Molecular Formula | C20H22N4O2S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | N-(4-hydroxyphenyl)-1-[(5-thiophen-3-yl-1H-pyrazol-4-yl)methyl]piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccc(O)cc1)C1CCN(Cc2cn[nH]c2-c2ccsc2)CC1 |
| InChI | InChI=1S/C20H22N4O2S/c25-18-3-1-17(2-4-18)22-20(26)14-5-8-24(9-6-14)12-16-11-21-23-19(16)15-7-10-27-13-15/h1-4,7,10-11,13-14,25H,5-6,8-9,12H2,(H,21,23)(H,22,26) |
| InChIKey | BQDUECXLGZVIIW-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 81.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|