C13H19ClN4S — CID 120840165
3-methyl-1-[(5-thiophen-3-yl-1H-pyrazol-4-yl)methyl]piperazine;hydrochloride (PubChem CID 120840165) has the molecular formula C13H19ClN4S and a molecular weight of 298.84 g/mol. Its IUPAC name is 3-methyl-1-[(5-thiophen-3-yl-1H-pyrazol-4-yl)methyl]piperazine;hydrochloride.
| Compound Name | 3-methyl-1-[(5-thiophen-3-yl-1H-pyrazol-4-yl)methyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 120840165 |
| Molecular Formula | C13H19ClN4S |
| Molecular Weight | 298.84 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 3-methyl-1-[(5-thiophen-3-yl-1H-pyrazol-4-yl)methyl]piperazine;hydrochloride |
| SMILES | CC1CN(Cc2cn[nH]c2-c2ccsc2)CCN1.Cl |
| InChI | InChI=1S/C13H18N4S.ClH/c1-10-7-17(4-3-14-10)8-12-6-15-16-13(12)11-2-5-18-9-11;/h2,5-6,9-10,14H,3-4,7-8H2,1H3,(H,15,16);1H |
| InChIKey | IENBVJIEIXPOJR-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.84 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |