C19H25N5O — CID 120839171
5-[(3aS,6aS)-2,3,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-3a-yl]-3-(6-piperidin-1-yl-3-pyridinyl)-1,2,4-oxadiazole (PubChem CID 120839171) has the molecular formula C19H25N5O and a molecular weight of 339.44 g/mol. Its IUPAC name is 5-[(3aS,6aS)-2,3,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-3a-yl]-3-(6-piperidin-1-yl-3-pyridinyl)-1,2,4-oxadiazole.
| Compound Name | 5-[(3aS,6aS)-2,3,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-3a-yl]-3-(6-piperidin-1-yl-3-pyridinyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 120839171 |
| Molecular Formula | C19H25N5O |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.21 |
| IUPAC Name | 5-[(3aS,6aS)-2,3,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-3a-yl]-3-(6-piperidin-1-yl-3-pyridinyl)-1,2,4-oxadiazole |
| SMILES | c1cc(N2CCCCC2)ncc1-c1noc([C@@]23CCC[C@@H]2CNC3)n1 |
| InChI | InChI=1S/C19H25N5O/c1-2-9-24(10-3-1)16-7-6-14(11-21-16)17-22-18(25-23-17)19-8-4-5-15(19)12-20-13-19/h6-7,11,15,20H,1-5,8-10,12-13H2/t15-,19-/m1/s1 |
| InChIKey | ZSSDCDLHEAEOQR-DNVCBOLYSA-N |
| XLogP | 2.76 |
| TPSA | 67.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |