About 4-(2,3-dihydro-1H-indol-7-ylmethyl)-3-thiophen-2-ylpiperazin-2-one;hydrochloride
4-(2,3-dihydro-1H-indol-7-ylmethyl)-3-thiophen-2-ylpiperazin-2-one;hydrochloride (PubChem CID 120848995) has the molecular formula C17H20ClN3OS
and a molecular weight of 349.89 g/mol. Its IUPAC name is 4-(2,3-dihydro-1H-indol-7-ylmethyl)-3-thiophen-2-ylpiperazin-2-one;hydrochloride.
Molecular Properties
| Compound Name | 4-(2,3-dihydro-1H-indol-7-ylmethyl)-3-thiophen-2-ylpiperazin-2-one;hydrochloride |
| PubChem CID | 120848995 |
| Molecular Formula | C17H20ClN3OS |
| Molecular Weight | 349.89 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | 4-(2,3-dihydro-1H-indol-7-ylmethyl)-3-thiophen-2-ylpiperazin-2-one;hydrochloride |
| SMILES | Cl.O=C1NCCN(Cc2cccc3c2NCC3)C1c1cccs1 |
| InChI | InChI=1S/C17H19N3OS.ClH/c21-17-16(14-5-2-10-22-14)20(9-8-19-17)11-13-4-1-3-12-6-7-18-15(12)13;/h1-5,10,16,18H,6-9,11H2,(H,19,21);1H |
| InChIKey | OMAGQPCKCDPOHF-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.89 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(2,3-dihydro-1H-indol-7-ylmethyl)-3-thiophen-2-ylpiperazin-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,3-dihydro-1H-indol-7-ylmethyl)-3-thiophen-2-ylpiperazin-2-one;hydrochloride?
The IUPAC name of 4-(2,3-dihydro-1H-indol-7-ylmethyl)-3-thiophen-2-ylpiperazin-2-one;hydrochloride (CID 120848995) is 4-(2,3-dihydro-1H-indol-7-ylmethyl)-3-thiophen-2-ylpiperazin-2-one;hydrochloride.
What is the SMILES notation for 4-(2,3-dihydro-1H-indol-7-ylmethyl)-3-thiophen-2-ylpiperazin-2-one;hydrochloride?
The canonical SMILES for 4-(2,3-dihydro-1H-indol-7-ylmethyl)-3-thiophen-2-ylpiperazin-2-one;hydrochloride is Cl.O=C1NCCN(Cc2cccc3c2NCC3)C1c1cccs1.
What is the InChIKey of 4-(2,3-dihydro-1H-indol-7-ylmethyl)-3-thiophen-2-ylpiperazin-2-one;hydrochloride?
The InChIKey is OMAGQPCKCDPOHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N3OS.ClH/c21-17-16(14-5-2-10-22-14)20(9-8-19-17)11-13-4-1-3-12-6-7-18-15(12)13;/h1-5,10,16,18H,6-9,11H2,(H,19,21);1H.
What are the key properties of 4-(2,3-dihydro-1H-indol-7-ylmethyl)-3-thiophen-2-ylpiperazin-2-one;hydrochloride?
4-(2,3-dihydro-1H-indol-7-ylmethyl)-3-thiophen-2-ylpiperazin-2-one;hydrochloride has a molecular weight of 349.89 g/mol, XLogP of 2.81, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,3-dihydro-1H-indol-7-ylmethyl)-3-thiophen-2-ylpiperazin-2-one;hydrochloride is sourced from PubChem (CID 120848995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).