C17H20F3N7O — CID 120854798
1-[5-[2-[5,7-dimethyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]ethyl]-1,2,4-oxadiazol-3-yl]cyclopentan-1-amine (PubChem CID 120854798) has the molecular formula C17H20F3N7O and a molecular weight of 395.39 g/mol. Its IUPAC name is 1-[5-[2-[5,7-dimethyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]ethyl]-1,2,4-oxadiazol-3-yl]cyclopentan-1-amine.
| Compound Name | 1-[5-[2-[5,7-dimethyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]ethyl]-1,2,4-oxadiazol-3-yl]cyclopentan-1-amine |
|---|---|
| PubChem CID | 120854798 |
| Molecular Formula | C17H20F3N7O |
| Molecular Weight | 395.39 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 1-[5-[2-[5,7-dimethyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]ethyl]-1,2,4-oxadiazol-3-yl]cyclopentan-1-amine |
| SMILES | Cc1nc2nc(C(F)(F)F)nn2c(C)c1CCc1nc(C2(N)CCCC2)no1 |
| InChI | InChI=1S/C17H20F3N7O/c1-9-11(10(2)27-15(22-9)24-14(25-27)17(18,19)20)5-6-12-23-13(26-28-12)16(21)7-3-4-8-16/h3-8,21H2,1-2H3 |
| InChIKey | WLLLLTGDLMREFL-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 108.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.39 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |