C10H19F3N2 — CID 120858149
2-methyl-1-[2-methyl-3-(trifluoromethyl)pyrrolidin-1-yl]propan-2-amine (PubChem CID 120858149) has the molecular formula C10H19F3N2 and a molecular weight of 224.27 g/mol. Its IUPAC name is 2-methyl-1-[2-methyl-3-(trifluoromethyl)pyrrolidin-1-yl]propan-2-amine.
| Compound Name | 2-methyl-1-[2-methyl-3-(trifluoromethyl)pyrrolidin-1-yl]propan-2-amine |
|---|---|
| PubChem CID | 120858149 |
| Molecular Formula | C10H19F3N2 |
| Molecular Weight | 224.27 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | 2-methyl-1-[2-methyl-3-(trifluoromethyl)pyrrolidin-1-yl]propan-2-amine |
| SMILES | CC1C(C(F)(F)F)CCN1CC(C)(C)N |
| InChI | InChI=1S/C10H19F3N2/c1-7-8(10(11,12)13)4-5-15(7)6-9(2,3)14/h7-8H,4-6,14H2,1-3H3 |
| InChIKey | RGEVLFCNESIBIE-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.27 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |