C9H15F3N2O — CID 126789756
4-methyl-1-(2,2,2-trifluoroethyl)piperidine-2-carboxamide (PubChem CID 126789756) has the molecular formula C9H15F3N2O and a molecular weight of 224.23 g/mol. Its IUPAC name is 4-methyl-1-(2,2,2-trifluoroethyl)piperidine-2-carboxamide.
| Compound Name | 4-methyl-1-(2,2,2-trifluoroethyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 126789756 |
| Molecular Formula | C9H15F3N2O |
| Molecular Weight | 224.23 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 4-methyl-1-(2,2,2-trifluoroethyl)piperidine-2-carboxamide |
| SMILES | CC1CCN(CC(F)(F)F)C(C(N)=O)C1 |
| InChI | InChI=1S/C9H15F3N2O/c1-6-2-3-14(5-9(10,11)12)7(4-6)8(13)15/h6-7H,2-5H2,1H3,(H2,13,15) |
| InChIKey | WOIRSIKZTBOWGJ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.23 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |