C13H23N3OS — CID 120858456
N-[2-[(2-amino-2-methylpropyl)-(thiophen-3-ylmethyl)amino]ethyl]acetamide (PubChem CID 120858456) has the molecular formula C13H23N3OS and a molecular weight of 269.41 g/mol. Its IUPAC name is N-[2-[(2-amino-2-methylpropyl)-(thiophen-3-ylmethyl)amino]ethyl]acetamide.
| Compound Name | N-[2-[(2-amino-2-methylpropyl)-(thiophen-3-ylmethyl)amino]ethyl]acetamide |
|---|---|
| PubChem CID | 120858456 |
| Molecular Formula | C13H23N3OS |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | N-[2-[(2-amino-2-methylpropyl)-(thiophen-3-ylmethyl)amino]ethyl]acetamide |
| SMILES | CC(=O)NCCN(Cc1ccsc1)CC(C)(C)N |
| InChI | InChI=1S/C13H23N3OS/c1-11(17)15-5-6-16(10-13(2,3)14)8-12-4-7-18-9-12/h4,7,9H,5-6,8,10,14H2,1-3H3,(H,15,17) |
| InChIKey | CPIDEJRTXYQTRX-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |