C8H14N2O3S — CID 120874897
N-(1-amino-2-methylpropan-2-yl)furan-2-sulfonamide (PubChem CID 120874897) has the molecular formula C8H14N2O3S and a molecular weight of 218.28 g/mol. Its IUPAC name is N-(1-amino-2-methylpropan-2-yl)furan-2-sulfonamide.
| Compound Name | N-(1-amino-2-methylpropan-2-yl)furan-2-sulfonamide |
|---|---|
| PubChem CID | 120874897 |
| Molecular Formula | C8H14N2O3S |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | N-(1-amino-2-methylpropan-2-yl)furan-2-sulfonamide |
| SMILES | CC(C)(CN)NS(=O)(=O)c1ccco1 |
| InChI | InChI=1S/C8H14N2O3S/c1-8(2,6-9)10-14(11,12)7-4-3-5-13-7/h3-5,10H,6,9H2,1-2H3 |
| InChIKey | MHOOTVFORUFRLH-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |