C13H21ClN2O4S — CID 120876034
6-methyl-N-[2-(propylamino)ethyl]-1,3-benzodioxole-5-sulfonamide;hydrochloride (PubChem CID 120876034) has the molecular formula C13H21ClN2O4S and a molecular weight of 336.84 g/mol. Its IUPAC name is 6-methyl-N-[2-(propylamino)ethyl]-1,3-benzodioxole-5-sulfonamide;hydrochloride.
| Compound Name | 6-methyl-N-[2-(propylamino)ethyl]-1,3-benzodioxole-5-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120876034 |
| Molecular Formula | C13H21ClN2O4S |
| Molecular Weight | 336.84 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 6-methyl-N-[2-(propylamino)ethyl]-1,3-benzodioxole-5-sulfonamide;hydrochloride |
| SMILES | CCCNCCNS(=O)(=O)c1cc2c(cc1C)OCO2.Cl |
| InChI | InChI=1S/C13H20N2O4S.ClH/c1-3-4-14-5-6-15-20(16,17)13-8-12-11(7-10(13)2)18-9-19-12;/h7-8,14-15H,3-6,9H2,1-2H3;1H |
| InChIKey | CIDORQVKZCGNMR-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.84 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|