C14H24N2O4S2 — CID 120716036
2,5-dimethyl-3-methylsulfonyl-N-[2-(propylamino)ethyl]benzenesulfonamide (PubChem CID 120716036) has the molecular formula C14H24N2O4S2 and a molecular weight of 348.49 g/mol. Its IUPAC name is 2,5-dimethyl-3-methylsulfonyl-N-[2-(propylamino)ethyl]benzenesulfonamide.
| Compound Name | 2,5-dimethyl-3-methylsulfonyl-N-[2-(propylamino)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 120716036 |
| Molecular Formula | C14H24N2O4S2 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 2,5-dimethyl-3-methylsulfonyl-N-[2-(propylamino)ethyl]benzenesulfonamide |
| SMILES | CCCNCCNS(=O)(=O)c1cc(C)cc(S(C)(=O)=O)c1C |
| InChI | InChI=1S/C14H24N2O4S2/c1-5-6-15-7-8-16-22(19,20)14-10-11(2)9-13(12(14)3)21(4,17)18/h9-10,15-16H,5-8H2,1-4H3 |
| InChIKey | YKOSVLDAULYQNU-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|