C11H15N5O2S — CID 120901642
2-[(2-amino-1,3-thiazol-5-yl)methyl]-1,3,4,8,9,9a-hexahydropyrazino[1,2-a]pyrazine-6,7-dione (PubChem CID 120901642) has the molecular formula C11H15N5O2S and a molecular weight of 281.34 g/mol. Its IUPAC name is 2-[(2-amino-1,3-thiazol-5-yl)methyl]-1,3,4,8,9,9a-hexahydropyrazino[1,2-a]pyrazine-6,7-dione.
| Compound Name | 2-[(2-amino-1,3-thiazol-5-yl)methyl]-1,3,4,8,9,9a-hexahydropyrazino[1,2-a]pyrazine-6,7-dione |
|---|---|
| PubChem CID | 120901642 |
| Molecular Formula | C11H15N5O2S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 2-[(2-amino-1,3-thiazol-5-yl)methyl]-1,3,4,8,9,9a-hexahydropyrazino[1,2-a]pyrazine-6,7-dione |
| SMILES | Nc1ncc(CN2CCN3C(=O)C(=O)NCC3C2)s1 |
| InChI | InChI=1S/C11H15N5O2S/c12-11-14-4-8(19-11)6-15-1-2-16-7(5-15)3-13-9(17)10(16)18/h4,7H,1-3,5-6H2,(H2,12,14)(H,13,17) |
| InChIKey | OALZLOHBRJKJHU-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|