About 5-[[3-(3,4-dichlorophenoxy)pyrrolidin-1-yl]methyl]-1,3-thiazol-2-amine
5-[[3-(3,4-dichlorophenoxy)pyrrolidin-1-yl]methyl]-1,3-thiazol-2-amine (PubChem CID 120904524) has the molecular formula C14H15Cl2N3OS
and a molecular weight of 344.27 g/mol. Its IUPAC name is 5-[[3-(3,4-dichlorophenoxy)pyrrolidin-1-yl]methyl]-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 5-[[3-(3,4-dichlorophenoxy)pyrrolidin-1-yl]methyl]-1,3-thiazol-2-amine |
| PubChem CID | 120904524 |
| Molecular Formula | C14H15Cl2N3OS |
| Molecular Weight | 344.27 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | 5-[[3-(3,4-dichlorophenoxy)pyrrolidin-1-yl]methyl]-1,3-thiazol-2-amine |
| SMILES | Nc1ncc(CN2CCC(Oc3ccc(Cl)c(Cl)c3)C2)s1 |
| InChI | InChI=1S/C14H15Cl2N3OS/c15-12-2-1-9(5-13(12)16)20-10-3-4-19(7-10)8-11-6-18-14(17)21-11/h1-2,5-6,10H,3-4,7-8H2,(H2,17,18) |
| InChIKey | FIWCSRCXZCGNJQ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.27 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[[3-(3,4-dichlorophenoxy)pyrrolidin-1-yl]methyl]-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[3-(3,4-dichlorophenoxy)pyrrolidin-1-yl]methyl]-1,3-thiazol-2-amine?
The IUPAC name of 5-[[3-(3,4-dichlorophenoxy)pyrrolidin-1-yl]methyl]-1,3-thiazol-2-amine (CID 120904524) is 5-[[3-(3,4-dichlorophenoxy)pyrrolidin-1-yl]methyl]-1,3-thiazol-2-amine.
What is the SMILES notation for 5-[[3-(3,4-dichlorophenoxy)pyrrolidin-1-yl]methyl]-1,3-thiazol-2-amine?
The canonical SMILES for 5-[[3-(3,4-dichlorophenoxy)pyrrolidin-1-yl]methyl]-1,3-thiazol-2-amine is Nc1ncc(CN2CCC(Oc3ccc(Cl)c(Cl)c3)C2)s1.
What is the InChIKey of 5-[[3-(3,4-dichlorophenoxy)pyrrolidin-1-yl]methyl]-1,3-thiazol-2-amine?
The InChIKey is FIWCSRCXZCGNJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15Cl2N3OS/c15-12-2-1-9(5-13(12)16)20-10-3-4-19(7-10)8-11-6-18-14(17)21-11/h1-2,5-6,10H,3-4,7-8H2,(H2,17,18).
What are the key properties of 5-[[3-(3,4-dichlorophenoxy)pyrrolidin-1-yl]methyl]-1,3-thiazol-2-amine?
5-[[3-(3,4-dichlorophenoxy)pyrrolidin-1-yl]methyl]-1,3-thiazol-2-amine has a molecular weight of 344.27 g/mol, XLogP of 3.69, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[3-(3,4-dichlorophenoxy)pyrrolidin-1-yl]methyl]-1,3-thiazol-2-amine is sourced from PubChem (CID 120904524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).