C18H18Cl2N6 — CID 120910576
1-[[1-(2,4-dichlorophenyl)triazol-4-yl]methyl]-2-pyridin-4-ylpiperazine (PubChem CID 120910576) has the molecular formula C18H18Cl2N6 and a molecular weight of 389.29 g/mol. Its IUPAC name is 1-[[1-(2,4-dichlorophenyl)triazol-4-yl]methyl]-2-pyridin-4-ylpiperazine.
| Compound Name | 1-[[1-(2,4-dichlorophenyl)triazol-4-yl]methyl]-2-pyridin-4-ylpiperazine |
|---|---|
| PubChem CID | 120910576 |
| Molecular Formula | C18H18Cl2N6 |
| Molecular Weight | 389.29 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | 1-[[1-(2,4-dichlorophenyl)triazol-4-yl]methyl]-2-pyridin-4-ylpiperazine |
| SMILES | Clc1ccc(-n2cc(CN3CCNCC3c3ccncc3)nn2)c(Cl)c1 |
| InChI | InChI=1S/C18H18Cl2N6/c19-14-1-2-17(16(20)9-14)26-12-15(23-24-26)11-25-8-7-22-10-18(25)13-3-5-21-6-4-13/h1-6,9,12,18,22H,7-8,10-11H2 |
| InChIKey | UBJGALRELNUBDO-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.29 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |