C18H18ClFN6 — CID 120768024
1-[[1-(2-chloro-4-fluorophenyl)triazol-4-yl]methyl]-2-pyridin-3-ylpiperazine (PubChem CID 120768024) has the molecular formula C18H18ClFN6 and a molecular weight of 372.84 g/mol. Its IUPAC name is 1-[[1-(2-chloro-4-fluorophenyl)triazol-4-yl]methyl]-2-pyridin-3-ylpiperazine.
| Compound Name | 1-[[1-(2-chloro-4-fluorophenyl)triazol-4-yl]methyl]-2-pyridin-3-ylpiperazine |
|---|---|
| PubChem CID | 120768024 |
| Molecular Formula | C18H18ClFN6 |
| Molecular Weight | 372.84 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | 1-[[1-(2-chloro-4-fluorophenyl)triazol-4-yl]methyl]-2-pyridin-3-ylpiperazine |
| SMILES | Fc1ccc(-n2cc(CN3CCNCC3c3cccnc3)nn2)c(Cl)c1 |
| InChI | InChI=1S/C18H18ClFN6/c19-16-8-14(20)3-4-17(16)26-12-15(23-24-26)11-25-7-6-22-10-18(25)13-2-1-5-21-9-13/h1-5,8-9,12,18,22H,6-7,10-11H2 |
| InChIKey | XUAHRQBCQHFHMM-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.84 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |