C11H12N2O2S2 — CID 120913165
3-[(2-thiophen-2-yl-1,3-thiazol-4-yl)methylamino]propanoic acid (PubChem CID 120913165) has the molecular formula C11H12N2O2S2 and a molecular weight of 268.36 g/mol. Its IUPAC name is 3-[(2-thiophen-2-yl-1,3-thiazol-4-yl)methylamino]propanoic acid.
| Compound Name | 3-[(2-thiophen-2-yl-1,3-thiazol-4-yl)methylamino]propanoic acid |
|---|---|
| PubChem CID | 120913165 |
| Molecular Formula | C11H12N2O2S2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | 3-[(2-thiophen-2-yl-1,3-thiazol-4-yl)methylamino]propanoic acid |
| SMILES | O=C(O)CCNCc1csc(-c2cccs2)n1 |
| InChI | InChI=1S/C11H12N2O2S2/c14-10(15)3-4-12-6-8-7-17-11(13-8)9-2-1-5-16-9/h1-2,5,7,12H,3-4,6H2,(H,14,15) |
| InChIKey | PGHFHVJJOMRDNS-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|