C15H20IN5O2 — CID 120913541
2-[[4-(4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 120913541) has the molecular formula C15H20IN5O2 and a molecular weight of 429.26 g/mol. Its IUPAC name is 2-[[4-(4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 2-[[4-(4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 120913541 |
| Molecular Formula | C15H20IN5O2 |
| Molecular Weight | 429.26 g/mol |
| Exact Mass | 429.07 |
| IUPAC Name | 2-[[4-(4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CC1(C2CC2)NC(=O)N(c2ccc(CN=C(N)N)cc2)C1=O.I |
| InChI | InChI=1S/C15H19N5O2.HI/c1-15(10-4-5-10)12(21)20(14(22)19-15)11-6-2-9(3-7-11)8-18-13(16)17;/h2-3,6-7,10H,4-5,8H2,1H3,(H,19,22)(H4,16,17,18);1H |
| InChIKey | IUYFQZCPFKNJLJ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.26 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|