C19H27N5O2 — CID 120913562
1-tert-butyl-2-[[4-(4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl)phenyl]methyl]guanidine (PubChem CID 120913562) has the molecular formula C19H27N5O2 and a molecular weight of 357.46 g/mol. Its IUPAC name is 1-tert-butyl-2-[[4-(4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl)phenyl]methyl]guanidine.
| Compound Name | 1-tert-butyl-2-[[4-(4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 120913562 |
| Molecular Formula | C19H27N5O2 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.22 |
| IUPAC Name | 1-tert-butyl-2-[[4-(4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl)phenyl]methyl]guanidine |
| SMILES | CC(C)(C)N/C(N)=N/Cc1ccc(N2C(=O)NC(C)(C3CC3)C2=O)cc1 |
| InChI | InChI=1S/C19H27N5O2/c1-18(2,3)22-16(20)21-11-12-5-9-14(10-6-12)24-15(25)19(4,13-7-8-13)23-17(24)26/h5-6,9-10,13H,7-8,11H2,1-4H3,(H,23,26)(H3,20,21,22) |
| InChIKey | GFULVXUOGROCSV-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 99.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|