C21H30IN5O2 — CID 120913547
N'-[[4-(4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl)phenyl]methyl]azepane-1-carboximidamide;hydroiodide (PubChem CID 120913547) has the molecular formula C21H30IN5O2 and a molecular weight of 511.41 g/mol. Its IUPAC name is N'-[[4-(4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl)phenyl]methyl]azepane-1-carboximidamide;hydroiodide.
| Compound Name | N'-[[4-(4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl)phenyl]methyl]azepane-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 120913547 |
| Molecular Formula | C21H30IN5O2 |
| Molecular Weight | 511.41 g/mol |
| Exact Mass | 511.14 |
| IUPAC Name | N'-[[4-(4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl)phenyl]methyl]azepane-1-carboximidamide;hydroiodide |
| SMILES | CC1(C2CC2)NC(=O)N(c2ccc(C/N=C(\N)N3CCCCCC3)cc2)C1=O.I |
| InChI | InChI=1S/C21H29N5O2.HI/c1-21(16-8-9-16)18(27)26(20(28)24-21)17-10-6-15(7-11-17)14-23-19(22)25-12-4-2-3-5-13-25;/h6-7,10-11,16H,2-5,8-9,12-14H2,1H3,(H2,22,23)(H,24,28);1H |
| InChIKey | CBQWEVZKWKLQAK-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 91.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.41 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|