C20H26N4O — CID 120916554
2-(6-methyl-1H-indol-3-yl)-N-[[(2R,3S)-2-(2-methylpyrazol-3-yl)oxolan-3-yl]methyl]ethanamine (PubChem CID 120916554) has the molecular formula C20H26N4O and a molecular weight of 338.45 g/mol. Its IUPAC name is 2-(6-methyl-1H-indol-3-yl)-N-[[(2R,3S)-2-(2-methylpyrazol-3-yl)oxolan-3-yl]methyl]ethanamine.
| Compound Name | 2-(6-methyl-1H-indol-3-yl)-N-[[(2R,3S)-2-(2-methylpyrazol-3-yl)oxolan-3-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 120916554 |
| Molecular Formula | C20H26N4O |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | 2-(6-methyl-1H-indol-3-yl)-N-[[(2R,3S)-2-(2-methylpyrazol-3-yl)oxolan-3-yl]methyl]ethanamine |
| SMILES | Cc1ccc2c(CCNC[C@@H]3CCO[C@H]3c3ccnn3C)c[nH]c2c1 |
| InChI | InChI=1S/C20H26N4O/c1-14-3-4-17-15(13-22-18(17)11-14)5-8-21-12-16-7-10-25-20(16)19-6-9-23-24(19)2/h3-4,6,9,11,13,16,20-22H,5,7-8,10,12H2,1-2H3/t16-,20+/m0/s1 |
| InChIKey | VRZXYECEJMWONN-OXJNMPFZSA-N |
| XLogP | 3.12 |
| TPSA | 54.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|