C20H23N5O3 — CID 120934516
N-[4-[(2,5-dioxopyrrolidin-3-yl)methyl]phenyl]-4-pyrazol-1-ylpiperidine-4-carboxamide (PubChem CID 120934516) has the molecular formula C20H23N5O3 and a molecular weight of 381.44 g/mol. Its IUPAC name is N-[4-[(2,5-dioxopyrrolidin-3-yl)methyl]phenyl]-4-pyrazol-1-ylpiperidine-4-carboxamide.
| Compound Name | N-[4-[(2,5-dioxopyrrolidin-3-yl)methyl]phenyl]-4-pyrazol-1-ylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 120934516 |
| Molecular Formula | C20H23N5O3 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | N-[4-[(2,5-dioxopyrrolidin-3-yl)methyl]phenyl]-4-pyrazol-1-ylpiperidine-4-carboxamide |
| SMILES | O=C1CC(Cc2ccc(NC(=O)C3(n4cccn4)CCNCC3)cc2)C(=O)N1 |
| InChI | InChI=1S/C20H23N5O3/c26-17-13-15(18(27)24-17)12-14-2-4-16(5-3-14)23-19(28)20(6-9-21-10-7-20)25-11-1-8-22-25/h1-5,8,11,15,21H,6-7,9-10,12-13H2,(H,23,28)(H,24,26,27) |
| InChIKey | ZLUPXHXTYWDHDH-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 105.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|