C19H21N5O3S — CID 120929482
N-[4-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]phenyl]-4-pyrazol-1-ylpiperidine-4-carboxamide (PubChem CID 120929482) has the molecular formula C19H21N5O3S and a molecular weight of 399.48 g/mol. Its IUPAC name is N-[4-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]phenyl]-4-pyrazol-1-ylpiperidine-4-carboxamide.
| Compound Name | N-[4-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]phenyl]-4-pyrazol-1-ylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 120929482 |
| Molecular Formula | C19H21N5O3S |
| Molecular Weight | 399.48 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | N-[4-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]phenyl]-4-pyrazol-1-ylpiperidine-4-carboxamide |
| SMILES | O=C1CSC(=O)N1Cc1ccc(NC(=O)C2(n3cccn3)CCNCC2)cc1 |
| InChI | InChI=1S/C19H21N5O3S/c25-16-13-28-18(27)23(16)12-14-2-4-15(5-3-14)22-17(26)19(6-9-20-10-7-19)24-11-1-8-21-24/h1-5,8,11,20H,6-7,9-10,12-13H2,(H,22,26) |
| InChIKey | QWGSQTGRSAWZKZ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.48 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|