C15H15F3N2O7 — CID 120950899
(3S,4S)-1-[2-(3-methoxy-4-nitrophenoxy)acetyl]-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid (PubChem CID 120950899) has the molecular formula C15H15F3N2O7 and a molecular weight of 392.29 g/mol. Its IUPAC name is (3S,4S)-1-[2-(3-methoxy-4-nitrophenoxy)acetyl]-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid.
| Compound Name | (3S,4S)-1-[2-(3-methoxy-4-nitrophenoxy)acetyl]-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 120950899 |
| Molecular Formula | C15H15F3N2O7 |
| Molecular Weight | 392.29 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | (3S,4S)-1-[2-(3-methoxy-4-nitrophenoxy)acetyl]-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid |
| SMILES | COc1cc(OCC(=O)N2C[C@@H](C(F)(F)F)[C@H](C(=O)O)C2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H15F3N2O7/c1-26-12-4-8(2-3-11(12)20(24)25)27-7-13(21)19-5-9(14(22)23)10(6-19)15(16,17)18/h2-4,9-10H,5-7H2,1H3,(H,22,23)/t9-,10-/m1/s1 |
| InChIKey | UVOAKBOPIJYVPU-NXEZZACHSA-N |
| XLogP | 1.70 |
| TPSA | 119.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.29 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|