C15H15F3N2O6 — CID 120951370
(3S,4S)-1-[3-(2-nitrophenoxy)propanoyl]-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid (PubChem CID 120951370) has the molecular formula C15H15F3N2O6 and a molecular weight of 376.29 g/mol. Its IUPAC name is (3S,4S)-1-[3-(2-nitrophenoxy)propanoyl]-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid.
| Compound Name | (3S,4S)-1-[3-(2-nitrophenoxy)propanoyl]-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 120951370 |
| Molecular Formula | C15H15F3N2O6 |
| Molecular Weight | 376.29 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | (3S,4S)-1-[3-(2-nitrophenoxy)propanoyl]-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CN(C(=O)CCOc2ccccc2[N+](=O)[O-])C[C@H]1C(F)(F)F |
| InChI | InChI=1S/C15H15F3N2O6/c16-15(17,18)10-8-19(7-9(10)14(22)23)13(21)5-6-26-12-4-2-1-3-11(12)20(24)25/h1-4,9-10H,5-8H2,(H,22,23)/t9-,10-/m1/s1 |
| InChIKey | IDBMLZWUEVDODJ-NXEZZACHSA-N |
| XLogP | 2.09 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.29 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|